About 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine
1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine (PubChem CID 176675845) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine.
Molecular Properties
| Compound Name | 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine |
| PubChem CID | 176675845 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine |
| SMILES | C=CC(COC)NC.CN1CCNCC1 |
| InChI | InChI=1S/C6H13NO.C5H12N2/c1-4-6(7-2)5-8-3;1-7-4-2-6-3-5-7/h4,6-7H,1,5H2,2-3H3;6H,2-5H2,1H3 |
| InChIKey | QZIIJXXOOAOONU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine?
The IUPAC name of 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine (CID 176675845) is 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine.
What is the SMILES notation for 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine?
The canonical SMILES for 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine is C=CC(COC)NC.CN1CCNCC1.
What is the InChIKey of 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine?
The InChIKey is QZIIJXXOOAOONU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C5H12N2/c1-4-6(7-2)5-8-3;1-7-4-2-6-3-5-7/h4,6-7H,1,5H2,2-3H3;6H,2-5H2,1H3.
What are the key properties of 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine?
1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine has a molecular weight of 215.34 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-N-methylbut-3-en-2-amine;1-methylpiperazine is sourced from PubChem (CID 176675845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).