C5H6N2ReRf-2 — CID 176676527
3,5-dimethyl-2,4-dihydroimidazole-2,4-diide;rhenium;rutherfordium (PubChem CID 176676527) has the molecular formula C5H6N2ReRf-2 and a molecular weight of 547.32 g/mol. Its IUPAC name is 3,5-dimethyl-2,4-dihydroimidazole-2,4-diide;rhenium;rutherfordium.
| Compound Name | 3,5-dimethyl-2,4-dihydroimidazole-2,4-diide;rhenium;rutherfordium |
|---|---|
| PubChem CID | 176676527 |
| Molecular Formula | C5H6N2ReRf-2 |
| Molecular Weight | 547.32 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 3,5-dimethyl-2,4-dihydroimidazole-2,4-diide;rhenium;rutherfordium |
| SMILES | Cc1[c-]n(C)[c-]n1.[Re].[Rf] |
| InChI | InChI=1S/C5H6N2.Re.Rf/c1-5-3-7(2)4-6-5;;/h1-2H3;;/q-2;; |
| InChIKey | QMBCSJJQTYDHAD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|