C5H6N2W7-2 — CID 20700577
1,5-dimethyl-2,4-dihydroimidazole-2,4-diide;tungsten (PubChem CID 20700577) has the molecular formula C5H6N2W7-2 and a molecular weight of 1381.00 g/mol. Its IUPAC name is 1,5-dimethyl-2,4-dihydroimidazole-2,4-diide;tungsten.
| Compound Name | 1,5-dimethyl-2,4-dihydroimidazole-2,4-diide;tungsten |
|---|---|
| PubChem CID | 20700577 |
| Molecular Formula | C5H6N2W7-2 |
| Molecular Weight | 1381.00 g/mol |
| Exact Mass | 1381.71 |
| IUPAC Name | 1,5-dimethyl-2,4-dihydroimidazole-2,4-diide;tungsten |
| SMILES | Cc1[c-]n[c-]n1C.[W].[W].[W].[W].[W].[W].[W] |
| InChI | InChI=1S/C5H6N2.7W/c1-5-3-6-4-7(5)2;;;;;;;/h1-2H3;;;;;;;/q-2;;;;;;; |
| InChIKey | HHAUTJGVCUCTJZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1381.00 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|