C5H7N2Y- — CID 59915028
1,5-dimethyl-4H-imidazol-4-ide;yttrium (PubChem CID 59915028) has the molecular formula C5H7N2Y- and a molecular weight of 184.03 g/mol. Its IUPAC name is 1,5-dimethyl-4H-imidazol-4-ide;yttrium.
| Compound Name | 1,5-dimethyl-4H-imidazol-4-ide;yttrium |
|---|---|
| PubChem CID | 59915028 |
| Molecular Formula | C5H7N2Y- |
| Molecular Weight | 184.03 g/mol |
| Exact Mass | 183.97 |
| IUPAC Name | 1,5-dimethyl-4H-imidazol-4-ide;yttrium |
| SMILES | Cc1[c-]ncn1C.[Y] |
| InChI | InChI=1S/C5H7N2.Y/c1-5-3-6-4-7(5)2;/h4H,1-2H3;/q-1; |
| InChIKey | QTUCQGYEPAHXEU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.03 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|