C10H14O3S — CID 176677309
4-(2-oxopentylsulfanyl)cyclopentane-1,3-dione (PubChem CID 176677309) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-(2-oxopentylsulfanyl)cyclopentane-1,3-dione.
| Compound Name | 4-(2-oxopentylsulfanyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 176677309 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 4-(2-oxopentylsulfanyl)cyclopentane-1,3-dione |
| SMILES | CCCC(=O)CSC1CC(=O)CC1=O |
| InChI | InChI=1S/C10H14O3S/c1-2-3-7(11)6-14-10-5-8(12)4-9(10)13/h10H,2-6H2,1H3 |
| InChIKey | VPDQFXJWHXWPNA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|