C20H34N2O4S — CID 159666001
1-[9-(2,4-dioxocyclopentyl)sulfanylnonyl]-3-[(2R)-3-oxopentan-2-yl]urea (PubChem CID 159666001) has the molecular formula C20H34N2O4S and a molecular weight of 398.57 g/mol. Its IUPAC name is 1-[9-(2,4-dioxocyclopentyl)sulfanylnonyl]-3-[(2R)-3-oxopentan-2-yl]urea.
| Compound Name | 1-[9-(2,4-dioxocyclopentyl)sulfanylnonyl]-3-[(2R)-3-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 159666001 |
| Molecular Formula | C20H34N2O4S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-[9-(2,4-dioxocyclopentyl)sulfanylnonyl]-3-[(2R)-3-oxopentan-2-yl]urea |
| SMILES | CCC(=O)[C@@H](C)NC(=O)NCCCCCCCCCSC1CC(=O)CC1=O |
| InChI | InChI=1S/C20H34N2O4S/c1-3-17(24)15(2)22-20(26)21-11-9-7-5-4-6-8-10-12-27-19-14-16(23)13-18(19)25/h15,19H,3-14H2,1-2H3,(H2,21,22,26)/t15-,19?/m1/s1 |
| InChIKey | MTKCXPVRDSQAKC-NYRJJRHWSA-N |
| XLogP | 3.42 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|