C6H8O2S2 — CID 89255747
4-(sulfanylmethylsulfanyl)cyclopentane-1,3-dione (PubChem CID 89255747) has the molecular formula C6H8O2S2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-(sulfanylmethylsulfanyl)cyclopentane-1,3-dione.
| Compound Name | 4-(sulfanylmethylsulfanyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 89255747 |
| Molecular Formula | C6H8O2S2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | 4-(sulfanylmethylsulfanyl)cyclopentane-1,3-dione |
| SMILES | O=C1CC(=O)C(SCS)C1 |
| InChI | InChI=1S/C6H8O2S2/c7-4-1-5(8)6(2-4)10-3-9/h6,9H,1-3H2 |
| InChIKey | ZWNSXMKEVYUCHS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|