C17H20O10S — CID 20654311
2,3-diacetyloxypropyl 5-(2,4-dioxocyclopentyl)sulfanyl-4,5-dioxopentanoate (PubChem CID 20654311) has the molecular formula C17H20O10S and a molecular weight of 416.40 g/mol. Its IUPAC name is 2,3-diacetyloxypropyl 5-(2,4-dioxocyclopentyl)sulfanyl-4,5-dioxopentanoate.
| Compound Name | 2,3-diacetyloxypropyl 5-(2,4-dioxocyclopentyl)sulfanyl-4,5-dioxopentanoate |
|---|---|
| PubChem CID | 20654311 |
| Molecular Formula | C17H20O10S |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2,3-diacetyloxypropyl 5-(2,4-dioxocyclopentyl)sulfanyl-4,5-dioxopentanoate |
| SMILES | CC(=O)OCC(COC(=O)CCC(=O)C(=O)SC1CC(=O)CC1=O)OC(C)=O |
| InChI | InChI=1S/C17H20O10S/c1-9(18)25-7-12(27-10(2)19)8-26-16(23)4-3-13(21)17(24)28-15-6-11(20)5-14(15)22/h12,15H,3-8H2,1-2H3 |
| InChIKey | PMJNTMBUOLDBCL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|