C19H25N3O10-2 — CID 54737841
4-(2,3-diacetyloxypropoxy)-4-oxobutanimidate;3-(2,5-dioxopyrrol-1-yl)-N-methylpropanimidate (PubChem CID 54737841) has the molecular formula C19H25N3O10-2 and a molecular weight of 455.42 g/mol. Its IUPAC name is 4-(2,3-diacetyloxypropoxy)-4-oxobutanimidate;3-(2,5-dioxopyrrol-1-yl)-N-methylpropanimidate.
| Compound Name | 4-(2,3-diacetyloxypropoxy)-4-oxobutanimidate;3-(2,5-dioxopyrrol-1-yl)-N-methylpropanimidate |
|---|---|
| PubChem CID | 54737841 |
| Molecular Formula | C19H25N3O10-2 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 4-(2,3-diacetyloxypropoxy)-4-oxobutanimidate;3-(2,5-dioxopyrrol-1-yl)-N-methylpropanimidate |
| SMILES | C/N=C(\[O-])CCN1C(=O)C=CC1=O.[H]/N=C(\[O-])CCC(=O)OCC(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C11H17NO7.C8H10N2O3/c1-7(13)17-5-9(19-8(2)14)6-18-11(16)4-3-10(12)15;1-9-6(11)4-5-10-7(12)2-3-8(10)13/h9H,3-6H2,1-2H3,(H2,12,15);2-3H,4-5H2,1H3,(H,9,11)/p-2 |
| InChIKey | ZMALBMXCLBHQTF-UHFFFAOYSA-L |
| XLogP | -2.17 |
| TPSA | 198.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|