C20H29N6O2S+ — CID 176678548
N-[1-[(2R,4R)-4-hydroxypyrrolidin-2-yl]ethyl]-4-(5,7,7-trimethylpyrrolo[2,3-d]pyrimidin-7-ium-4-yl)-2,3-dihydro-1,4-thiazine-6-carboxamide (PubChem CID 176678548) has the molecular formula C20H29N6O2S+ and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[1-[(2R,4R)-4-hydroxypyrrolidin-2-yl]ethyl]-4-(5,7,7-trimethylpyrrolo[2,3-d]pyrimidin-7-ium-4-yl)-2,3-dihydro-1,4-thiazine-6-carboxamide.
| Compound Name | N-[1-[(2R,4R)-4-hydroxypyrrolidin-2-yl]ethyl]-4-(5,7,7-trimethylpyrrolo[2,3-d]pyrimidin-7-ium-4-yl)-2,3-dihydro-1,4-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 176678548 |
| Molecular Formula | C20H29N6O2S+ |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[1-[(2R,4R)-4-hydroxypyrrolidin-2-yl]ethyl]-4-(5,7,7-trimethylpyrrolo[2,3-d]pyrimidin-7-ium-4-yl)-2,3-dihydro-1,4-thiazine-6-carboxamide |
| SMILES | CC1=C[N+](C)(C)c2ncnc(N3C=C(C(=O)NC(C)[C@H]4C[C@@H](O)CN4)SCC3)c21 |
| InChI | InChI=1S/C20H28N6O2S/c1-12-10-26(3,4)19-17(12)18(22-11-23-19)25-5-6-29-16(9-25)20(28)24-13(2)15-7-14(27)8-21-15/h9-11,13-15,21,27H,5-8H2,1-4H3/p+1/t13?,14-,15-/m1/s1 |
| InChIKey | XDNVMPHSKADLKH-JVIGXAJISA-O |
| XLogP | 1.04 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|