C17H38N2O2 — CID 176678762
ethane;N-(2-ethoxyethyl)-2,2,3,3-tetramethyl-4-(propan-2-ylamino)butanamide (PubChem CID 176678762) has the molecular formula C17H38N2O2 and a molecular weight of 302.50 g/mol. Its IUPAC name is ethane;N-(2-ethoxyethyl)-2,2,3,3-tetramethyl-4-(propan-2-ylamino)butanamide.
| Compound Name | ethane;N-(2-ethoxyethyl)-2,2,3,3-tetramethyl-4-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 176678762 |
| Molecular Formula | C17H38N2O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.29 |
| IUPAC Name | ethane;N-(2-ethoxyethyl)-2,2,3,3-tetramethyl-4-(propan-2-ylamino)butanamide |
| SMILES | CC.CCOCCNC(=O)C(C)(C)C(C)(C)CNC(C)C |
| InChI | InChI=1S/C15H32N2O2.C2H6/c1-8-19-10-9-16-13(18)15(6,7)14(4,5)11-17-12(2)3;1-2/h12,17H,8-11H2,1-7H3,(H,16,18);1-2H3 |
| InChIKey | BXSCVKAWBQFKLW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|