C19H37N3O — CID 176684022
5-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]pent-1-en-3-one;propane (PubChem CID 176684022) has the molecular formula C19H37N3O and a molecular weight of 323.53 g/mol. Its IUPAC name is 5-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]pent-1-en-3-one;propane.
| Compound Name | 5-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]pent-1-en-3-one;propane |
|---|---|
| PubChem CID | 176684022 |
| Molecular Formula | C19H37N3O |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.29 |
| IUPAC Name | 5-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]pent-1-en-3-one;propane |
| SMILES | C=CC(=O)CCN1CCC(CCN2CCNCC2)CC1.CCC |
| InChI | InChI=1S/C16H29N3O.C3H8/c1-2-16(20)6-12-18-9-3-15(4-10-18)5-11-19-13-7-17-8-14-19;1-3-2/h2,15,17H,1,3-14H2;3H2,1-2H3 |
| InChIKey | WJWLJFYSDBJFBW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|