C26H49N5O — CID 143598619
1-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]propan-2-one;N-[(Z)-2,2,6,6-tetramethylhept-4-en-3-ylidene]methanimidamide (PubChem CID 143598619) has the molecular formula C26H49N5O and a molecular weight of 447.71 g/mol. Its IUPAC name is 1-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]propan-2-one;N-[(Z)-2,2,6,6-tetramethylhept-4-en-3-ylidene]methanimidamide.
| Compound Name | 1-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]propan-2-one;N-[(Z)-2,2,6,6-tetramethylhept-4-en-3-ylidene]methanimidamide |
|---|---|
| PubChem CID | 143598619 |
| Molecular Formula | C26H49N5O |
| Molecular Weight | 447.71 g/mol |
| Exact Mass | 447.39 |
| IUPAC Name | 1-[4-(2-piperazin-1-ylethyl)piperidin-1-yl]propan-2-one;N-[(Z)-2,2,6,6-tetramethylhept-4-en-3-ylidene]methanimidamide |
| SMILES | CC(=O)CN1CCC(CCN2CCNCC2)CC1.[H]/N=C\N=C(\C=C/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H27N3O.C12H22N2/c1-13(18)12-17-8-3-14(4-9-17)2-7-16-10-5-15-6-11-16;1-11(2,3)8-7-10(14-9-13)12(4,5)6/h14-15H,2-12H2,1H3;7-9,13H,1-6H3/b;8-7-,13-9-,14-10- |
| InChIKey | WEYPKDYJXABITN-WPTDJROBSA-N |
| XLogP | 4.27 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|