About methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene
methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene (PubChem CID 176684153) has the molecular formula C19H36N2O2
and a molecular weight of 324.51 g/mol. Its IUPAC name is methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene.
Molecular Properties
| Compound Name | methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene |
| PubChem CID | 176684153 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene |
| SMILES | C.C=CC.CCC(=O)C1CCC(C(=O)N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C15H26N2O2.C3H6.CH4/c1-3-14(18)12-4-6-13(7-5-12)15(19)17-10-8-16(2)9-11-17;1-3-2;/h12-13H,3-11H2,1-2H3;3H,1H2,2H3;1H4 |
| InChIKey | LRRPVBGKEDCECP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene?
The IUPAC name of methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene (CID 176684153) is methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene.
What is the SMILES notation for methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene?
The canonical SMILES for methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene is C.C=CC.CCC(=O)C1CCC(C(=O)N2CCN(C)CC2)CC1.
What is the InChIKey of methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene?
The InChIKey is LRRPVBGKEDCECP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O2.C3H6.CH4/c1-3-14(18)12-4-6-13(7-5-12)15(19)17-10-8-16(2)9-11-17;1-3-2;/h12-13H,3-11H2,1-2H3;3H,1H2,2H3;1H4.
What are the key properties of methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene?
methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene has a molecular weight of 324.51 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-[4-(4-methylpiperazine-1-carbonyl)cyclohexyl]propan-1-one;prop-1-ene is sourced from PubChem (CID 176684153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).