C25H33N7O — CID 176685312
(E)-4-[4-[4-(2,2-dimethylpropanoyl)-3-methylpiperazin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-7-yl]-2-ethenyl-4-methyliminobut-2-enenitrile (PubChem CID 176685312) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is (E)-4-[4-[4-(2,2-dimethylpropanoyl)-3-methylpiperazin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-7-yl]-2-ethenyl-4-methyliminobut-2-enenitrile.
| Compound Name | (E)-4-[4-[4-(2,2-dimethylpropanoyl)-3-methylpiperazin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-7-yl]-2-ethenyl-4-methyliminobut-2-enenitrile |
|---|---|
| PubChem CID | 176685312 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | (E)-4-[4-[4-(2,2-dimethylpropanoyl)-3-methylpiperazin-1-yl]spiro[6H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopropane]-7-yl]-2-ethenyl-4-methyliminobut-2-enenitrile |
| SMILES | C=C/C(C#N)=C\C(=N/C)N1CC2(CC2)c2c(N3CCN(C(=O)C(C)(C)C)C(C)C3)ncnc21 |
| InChI | InChI=1S/C25H33N7O/c1-7-18(13-26)12-19(27-6)32-15-25(8-9-25)20-21(28-16-29-22(20)32)30-10-11-31(17(2)14-30)23(33)24(3,4)5/h7,12,16-17H,1,8-11,14-15H2,2-6H3/b18-12+,27-19+ |
| InChIKey | KVPDXZBHSRCFNP-MSAIBCSISA-N |
| XLogP | 3.08 |
| TPSA | 88.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|