C20H18F3N5OS — CID 176685359
2-[(8-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[2-(trifluoromethyl)anilino]ethanol (PubChem CID 176685359) has the molecular formula C20H18F3N5OS and a molecular weight of 433.46 g/mol. Its IUPAC name is 2-[(8-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[2-(trifluoromethyl)anilino]ethanol.
| Compound Name | 2-[(8-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[2-(trifluoromethyl)anilino]ethanol |
|---|---|
| PubChem CID | 176685359 |
| Molecular Formula | C20H18F3N5OS |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[(8-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-1-[2-(trifluoromethyl)anilino]ethanol |
| SMILES | CCc1ccc2[nH]c3nc(SCC(O)Nc4ccccc4C(F)(F)F)nnc3c2c1 |
| InChI | InChI=1S/C20H18F3N5OS/c1-2-11-7-8-14-12(9-11)17-18(25-14)26-19(28-27-17)30-10-16(29)24-15-6-4-3-5-13(15)20(21,22)23/h3-9,16,24,29H,2,10H2,1H3,(H,25,26,28) |
| InChIKey | MOFJMIMDHUGXCP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|