About butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine
butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine (PubChem CID 176685935) has the molecular formula C14H27FN2O
and a molecular weight of 258.38 g/mol. Its IUPAC name is butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine.
Molecular Properties
| Compound Name | butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine |
| PubChem CID | 176685935 |
| Molecular Formula | C14H27FN2O |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine |
| SMILES | CC.CCCCO.CCc1ccc(C(C)F)nn1 |
| InChI | InChI=1S/C8H11FN2.C4H10O.C2H6/c1-3-7-4-5-8(6(2)9)11-10-7;1-2-3-4-5;1-2/h4-6H,3H2,1-2H3;5H,2-4H2,1H3;1-2H3 |
| InChIKey | NIPWMJNTLMYMLN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine?
The IUPAC name of butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine (CID 176685935) is butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine.
What is the SMILES notation for butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine?
The canonical SMILES for butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine is CC.CCCCO.CCc1ccc(C(C)F)nn1.
What is the InChIKey of butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine?
The InChIKey is NIPWMJNTLMYMLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2.C4H10O.C2H6/c1-3-7-4-5-8(6(2)9)11-10-7;1-2-3-4-5;1-2/h4-6H,3H2,1-2H3;5H,2-4H2,1H3;1-2H3.
What are the key properties of butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine?
butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine has a molecular weight of 258.38 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;ethane;3-ethyl-6-(1-fluoroethyl)pyridazine is sourced from PubChem (CID 176685935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).