C20H29N5O3 — CID 176690371
6-[[(3R)-1-ethylpiperidin-3-yl]amino]-3-(4-hydroxy-6-methyl-2,3,4,5-tetrahydro-1-benzofuran-5-yl)-4-methyl-1,2,4-triazin-5-one (PubChem CID 176690371) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 6-[[(3R)-1-ethylpiperidin-3-yl]amino]-3-(4-hydroxy-6-methyl-2,3,4,5-tetrahydro-1-benzofuran-5-yl)-4-methyl-1,2,4-triazin-5-one.
| Compound Name | 6-[[(3R)-1-ethylpiperidin-3-yl]amino]-3-(4-hydroxy-6-methyl-2,3,4,5-tetrahydro-1-benzofuran-5-yl)-4-methyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 176690371 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 6-[[(3R)-1-ethylpiperidin-3-yl]amino]-3-(4-hydroxy-6-methyl-2,3,4,5-tetrahydro-1-benzofuran-5-yl)-4-methyl-1,2,4-triazin-5-one |
| SMILES | CCN1CCC[C@@H](Nc2nnc(C3C(C)=CC4=C(CCO4)C3O)n(C)c2=O)C1 |
| InChI | InChI=1S/C20H29N5O3/c1-4-25-8-5-6-13(11-25)21-18-20(27)24(3)19(23-22-18)16-12(2)10-15-14(17(16)26)7-9-28-15/h10,13,16-17,26H,4-9,11H2,1-3H3,(H,21,22)/t13-,16?,17?/m1/s1 |
| InChIKey | CZDCZHSAKBKWBR-NVPAJSRCSA-N |
| XLogP | 1.15 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |