About (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid
(3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid (PubChem CID 176690697) has the molecular formula C17H18ClNO2
and a molecular weight of 303.79 g/mol. Its IUPAC name is (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid.
Molecular Properties
| Compound Name | (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid |
| PubChem CID | 176690697 |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid |
| SMILES | Cc1cccc(C)c1-c1cc(Cl)nc([C@@H](C)CC(=O)O)c1 |
| InChI | InChI=1S/C17H18ClNO2/c1-10-5-4-6-11(2)17(10)13-8-14(19-15(18)9-13)12(3)7-16(20)21/h4-6,8-9,12H,7H2,1-3H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | HZEIYCOTDMIPPI-LBPRGKRZSA-N |
| XLogP | 4.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid?
The IUPAC name of (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid (CID 176690697) is (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid.
What is the SMILES notation for (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid?
The canonical SMILES for (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid is Cc1cccc(C)c1-c1cc(Cl)nc([C@@H](C)CC(=O)O)c1.
What is the InChIKey of (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid?
The InChIKey is HZEIYCOTDMIPPI-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H18ClNO2/c1-10-5-4-6-11(2)17(10)13-8-14(19-15(18)9-13)12(3)7-16(20)21/h4-6,8-9,12H,7H2,1-3H3,(H,20,21)/t12-/m0/s1.
What are the key properties of (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid?
(3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid has a molecular weight of 303.79 g/mol, XLogP of 4.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[6-chloro-4-(2,6-dimethylphenyl)-2-pyridinyl]butanoic acid is sourced from PubChem (CID 176690697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).