C25H24ClFN6OS — CID 176692507
8-[1-[(2-aminosulfanyl-6-chloro-3-pyridinyl)amino]ethyl]-2-(5-fluoro-1,3-dihydroisoindol-2-yl)-3,6-dimethylquinazolin-4-one (PubChem CID 176692507) has the molecular formula C25H24ClFN6OS and a molecular weight of 511.03 g/mol. Its IUPAC name is 8-[1-[(2-aminosulfanyl-6-chloro-3-pyridinyl)amino]ethyl]-2-(5-fluoro-1,3-dihydroisoindol-2-yl)-3,6-dimethylquinazolin-4-one.
| Compound Name | 8-[1-[(2-aminosulfanyl-6-chloro-3-pyridinyl)amino]ethyl]-2-(5-fluoro-1,3-dihydroisoindol-2-yl)-3,6-dimethylquinazolin-4-one |
|---|---|
| PubChem CID | 176692507 |
| Molecular Formula | C25H24ClFN6OS |
| Molecular Weight | 511.03 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 8-[1-[(2-aminosulfanyl-6-chloro-3-pyridinyl)amino]ethyl]-2-(5-fluoro-1,3-dihydroisoindol-2-yl)-3,6-dimethylquinazolin-4-one |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2SN)c2nc(N3Cc4ccc(F)cc4C3)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C25H24ClFN6OS/c1-13-8-18(14(2)29-20-6-7-21(26)30-23(20)35-28)22-19(9-13)24(34)32(3)25(31-22)33-11-15-4-5-17(27)10-16(15)12-33/h4-10,14,29H,11-12,28H2,1-3H3 |
| InChIKey | WIEFGFPINSADGH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|