C27H26ClFN6O2S — CID 176692992
N-[[6-chloro-3-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-2-pyridinyl]sulfanyl]acetamide (PubChem CID 176692992) has the molecular formula C27H26ClFN6O2S and a molecular weight of 553.06 g/mol. Its IUPAC name is N-[[6-chloro-3-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-[[6-chloro-3-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 176692992 |
| Molecular Formula | C27H26ClFN6O2S |
| Molecular Weight | 553.06 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | N-[[6-chloro-3-[1-[2-(5-fluoro-1,3-dihydroisoindol-2-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-2-pyridinyl]sulfanyl]acetamide |
| SMILES | CC(=O)NSc1nc(Cl)ccc1NC(C)c1cc(C)cc2c(=O)n(C)c(N3Cc4ccc(F)cc4C3)nc12 |
| InChI | InChI=1S/C27H26ClFN6O2S/c1-14-9-20(15(2)30-22-7-8-23(28)31-25(22)38-33-16(3)36)24-21(10-14)26(37)34(4)27(32-24)35-12-17-5-6-19(29)11-18(17)13-35/h5-11,15,30H,12-13H2,1-4H3,(H,33,36) |
| InChIKey | IJIOPUXULWYJSJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.06 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|