C24H27ClN6O2S — CID 176692742
3-[1-[2-(3-azabicyclo[3.1.0]hexan-6-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-6-chloro-N-methylsulfanylpyridine-2-carboxamide (PubChem CID 176692742) has the molecular formula C24H27ClN6O2S and a molecular weight of 499.04 g/mol. Its IUPAC name is 3-[1-[2-(3-azabicyclo[3.1.0]hexan-6-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-6-chloro-N-methylsulfanylpyridine-2-carboxamide.
| Compound Name | 3-[1-[2-(3-azabicyclo[3.1.0]hexan-6-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-6-chloro-N-methylsulfanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176692742 |
| Molecular Formula | C24H27ClN6O2S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 3-[1-[2-(3-azabicyclo[3.1.0]hexan-6-yl)-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-6-chloro-N-methylsulfanylpyridine-2-carboxamide |
| SMILES | CSNC(=O)c1nc(Cl)ccc1NC(C)c1cc(C)cc2c(=O)n(C)c(C3C4CNCC43)nc12 |
| InChI | InChI=1S/C24H27ClN6O2S/c1-11-7-13(12(2)27-17-5-6-18(25)28-21(17)23(32)30-34-4)20-14(8-11)24(33)31(3)22(29-20)19-15-9-26-10-16(15)19/h5-8,12,15-16,19,26-27H,9-10H2,1-4H3,(H,30,32) |
| InChIKey | WGVMLTBCBJYLNK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|