C24H23ClN6O3S — CID 176692114
6-chloro-3-[1-[3,6-dimethyl-4-oxo-2-(6-oxo-1H-pyridin-3-yl)quinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide (PubChem CID 176692114) has the molecular formula C24H23ClN6O3S and a molecular weight of 511.01 g/mol. Its IUPAC name is 6-chloro-3-[1-[3,6-dimethyl-4-oxo-2-(6-oxo-1H-pyridin-3-yl)quinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-[3,6-dimethyl-4-oxo-2-(6-oxo-1H-pyridin-3-yl)quinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176692114 |
| Molecular Formula | C24H23ClN6O3S |
| Molecular Weight | 511.01 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 6-chloro-3-[1-[3,6-dimethyl-4-oxo-2-(6-oxo-1H-pyridin-3-yl)quinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide |
| SMILES | CSNC(=O)c1nc(Cl)ccc1NC(C)c1cc(C)cc2c(=O)n(C)c(-c3ccc(=O)[nH]c3)nc12 |
| InChI | InChI=1S/C24H23ClN6O3S/c1-12-9-15(13(2)27-17-6-7-18(25)28-21(17)23(33)30-35-4)20-16(10-12)24(34)31(3)22(29-20)14-5-8-19(32)26-11-14/h5-11,13,27H,1-4H3,(H,26,32)(H,30,33) |
| InChIKey | BWUSYONCIOISAL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.01 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|