C27H36ClN8O2PS — CID 176692032
6-chloro-3-[1-[2-[ethylphosphanylmethyl(methyl)amino]-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide;1-methylpyrazole (PubChem CID 176692032) has the molecular formula C27H36ClN8O2PS and a molecular weight of 603.13 g/mol. Its IUPAC name is 6-chloro-3-[1-[2-[ethylphosphanylmethyl(methyl)amino]-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide;1-methylpyrazole.
| Compound Name | 6-chloro-3-[1-[2-[ethylphosphanylmethyl(methyl)amino]-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide;1-methylpyrazole |
|---|---|
| PubChem CID | 176692032 |
| Molecular Formula | C27H36ClN8O2PS |
| Molecular Weight | 603.13 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 6-chloro-3-[1-[2-[ethylphosphanylmethyl(methyl)amino]-3,6-dimethyl-4-oxoquinazolin-8-yl]ethylamino]-N-methylsulfanylpyridine-2-carboxamide;1-methylpyrazole |
| SMILES | CCPCN(C)c1nc2c(C(C)Nc3ccc(Cl)nc3C(=O)NSC)cc(C)cc2c(=O)n1C.Cn1cccn1 |
| InChI | InChI=1S/C23H30ClN6O2PS.C4H6N2/c1-7-33-12-29(4)23-27-19-15(10-13(2)11-16(19)22(32)30(23)5)14(3)25-17-8-9-18(24)26-20(17)21(31)28-34-6;1-6-4-2-3-5-6/h8-11,14,25,33H,7,12H2,1-6H3,(H,28,31);2-4H,1H3 |
| InChIKey | DTQYDLGKIUWCTQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.13 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|