About 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine
2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine (PubChem CID 176694052) has the molecular formula C22H48N2O
and a molecular weight of 356.64 g/mol. Its IUPAC name is 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine.
Molecular Properties
| Compound Name | 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine |
| PubChem CID | 176694052 |
| Molecular Formula | C22H48N2O |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.38 |
| IUPAC Name | 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine |
| SMILES | CC(C)CCCC1CN(C)CCO1.CCCCCC(N)CCC(C)C |
| InChI | InChI=1S/C11H23NO.C11H25N/c1-10(2)5-4-6-11-9-12(3)7-8-13-11;1-4-5-6-7-11(12)9-8-10(2)3/h10-11H,4-9H2,1-3H3;10-11H,4-9,12H2,1-3H3 |
| InChIKey | BRAHWTDOKGNLKG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine?
The IUPAC name of 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine (CID 176694052) is 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine.
What is the SMILES notation for 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine?
The canonical SMILES for 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine is CC(C)CCCC1CN(C)CCO1.CCCCCC(N)CCC(C)C.
What is the InChIKey of 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine?
The InChIKey is BRAHWTDOKGNLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO.C11H25N/c1-10(2)5-4-6-11-9-12(3)7-8-13-11;1-4-5-6-7-11(12)9-8-10(2)3/h10-11H,4-9H2,1-3H3;10-11H,4-9,12H2,1-3H3.
What are the key properties of 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine?
2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine has a molecular weight of 356.64 g/mol, XLogP of 5.47, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldecan-5-amine;4-methyl-2-(4-methylpentyl)morpholine is sourced from PubChem (CID 176694052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).