C21H27F3N4OS — CID 176694674
3-[ethyl(pentyl)amino]-5-methyl-N-(3-methylsulfanylphenyl)-6-(trifluoromethyl)pyridazine-4-carboxamide (PubChem CID 176694674) has the molecular formula C21H27F3N4OS and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-[ethyl(pentyl)amino]-5-methyl-N-(3-methylsulfanylphenyl)-6-(trifluoromethyl)pyridazine-4-carboxamide.
| Compound Name | 3-[ethyl(pentyl)amino]-5-methyl-N-(3-methylsulfanylphenyl)-6-(trifluoromethyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 176694674 |
| Molecular Formula | C21H27F3N4OS |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 3-[ethyl(pentyl)amino]-5-methyl-N-(3-methylsulfanylphenyl)-6-(trifluoromethyl)pyridazine-4-carboxamide |
| SMILES | CCCCCN(CC)c1nnc(C(F)(F)F)c(C)c1C(=O)Nc1cccc(SC)c1 |
| InChI | InChI=1S/C21H27F3N4OS/c1-5-7-8-12-28(6-2)19-17(14(3)18(26-27-19)21(22,23)24)20(29)25-15-10-9-11-16(13-15)30-4/h9-11,13H,5-8,12H2,1-4H3,(H,25,29) |
| InChIKey | HXXKMKPSLWLQHX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|