C20H25F3N4OS — CID 176694574
3-(ethylamino)-N-(3-methylsulfanylphenyl)-N-pentyl-6-(trifluoromethyl)pyridazine-4-carboxamide (PubChem CID 176694574) has the molecular formula C20H25F3N4OS and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-(ethylamino)-N-(3-methylsulfanylphenyl)-N-pentyl-6-(trifluoromethyl)pyridazine-4-carboxamide.
| Compound Name | 3-(ethylamino)-N-(3-methylsulfanylphenyl)-N-pentyl-6-(trifluoromethyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 176694574 |
| Molecular Formula | C20H25F3N4OS |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3-(ethylamino)-N-(3-methylsulfanylphenyl)-N-pentyl-6-(trifluoromethyl)pyridazine-4-carboxamide |
| SMILES | CCCCCN(C(=O)c1cc(C(F)(F)F)nnc1NCC)c1cccc(SC)c1 |
| InChI | InChI=1S/C20H25F3N4OS/c1-4-6-7-11-27(14-9-8-10-15(12-14)29-3)19(28)16-13-17(20(21,22)23)25-26-18(16)24-5-2/h8-10,12-13H,4-7,11H2,1-3H3,(H,24,26) |
| InChIKey | SFRXXKDXAVXKBE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|