C19H34N2O2 — CID 176694999
[3-[(1-methylpiperidin-4-yl)methyl]-3-azaspiro[5.5]undecan-9-yl] acetate (PubChem CID 176694999) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is [3-[(1-methylpiperidin-4-yl)methyl]-3-azaspiro[5.5]undecan-9-yl] acetate.
| Compound Name | [3-[(1-methylpiperidin-4-yl)methyl]-3-azaspiro[5.5]undecan-9-yl] acetate |
|---|---|
| PubChem CID | 176694999 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | [3-[(1-methylpiperidin-4-yl)methyl]-3-azaspiro[5.5]undecan-9-yl] acetate |
| SMILES | CC(=O)OC1CCC2(CC1)CCN(CC1CCN(C)CC1)CC2 |
| InChI | InChI=1S/C19H34N2O2/c1-16(22)23-18-3-7-19(8-4-18)9-13-21(14-10-19)15-17-5-11-20(2)12-6-17/h17-18H,3-15H2,1-2H3 |
| InChIKey | QEOCFMWEKOLKJT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |