C19H22N4O4 — CID 176695594
1-[6-(2,6-dioxopiperidin-3-yl)-7-methyl-5-oxo-7H-pyrrolo[3,4-b]pyridin-2-yl]piperidine-4-carbaldehyde (PubChem CID 176695594) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-[6-(2,6-dioxopiperidin-3-yl)-7-methyl-5-oxo-7H-pyrrolo[3,4-b]pyridin-2-yl]piperidine-4-carbaldehyde.
| Compound Name | 1-[6-(2,6-dioxopiperidin-3-yl)-7-methyl-5-oxo-7H-pyrrolo[3,4-b]pyridin-2-yl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 176695594 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-[6-(2,6-dioxopiperidin-3-yl)-7-methyl-5-oxo-7H-pyrrolo[3,4-b]pyridin-2-yl]piperidine-4-carbaldehyde |
| SMILES | CC1c2nc(N3CCC(C=O)CC3)ccc2C(=O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C19H22N4O4/c1-11-17-13(19(27)23(11)14-3-5-16(25)21-18(14)26)2-4-15(20-17)22-8-6-12(10-24)7-9-22/h2,4,10-12,14H,3,5-9H2,1H3,(H,21,25,26) |
| InChIKey | KDWFLKOWBFLIOR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|