C19H19N3O5 — CID 170362070
(3R)-1-[2-(2,6-dioxopiperidin-3-yl)-6-methyl-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carbaldehyde (PubChem CID 170362070) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is (3R)-1-[2-(2,6-dioxopiperidin-3-yl)-6-methyl-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carbaldehyde.
| Compound Name | (3R)-1-[2-(2,6-dioxopiperidin-3-yl)-6-methyl-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 170362070 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (3R)-1-[2-(2,6-dioxopiperidin-3-yl)-6-methyl-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carbaldehyde |
| SMILES | Cc1cc2c(cc1N1CC[C@@H](C=O)C1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H19N3O5/c1-10-6-12-13(7-15(10)21-5-4-11(8-21)9-23)19(27)22(18(12)26)14-2-3-16(24)20-17(14)25/h6-7,9,11,14H,2-5,8H2,1H3,(H,20,24,25)/t11-,14?/m1/s1 |
| InChIKey | UVBXLBPTNQFHPY-YNODCEANSA-N |
| XLogP | 0.42 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|