C21H29NO2 — CID 176695864
(E)-1-(4-propan-2-ylpiperidin-1-yl)-4-(4-propylphenyl)but-2-ene-1,4-dione (PubChem CID 176695864) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (E)-1-(4-propan-2-ylpiperidin-1-yl)-4-(4-propylphenyl)but-2-ene-1,4-dione.
| Compound Name | (E)-1-(4-propan-2-ylpiperidin-1-yl)-4-(4-propylphenyl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 176695864 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (E)-1-(4-propan-2-ylpiperidin-1-yl)-4-(4-propylphenyl)but-2-ene-1,4-dione |
| SMILES | CCCc1ccc(C(=O)/C=C/C(=O)N2CCC(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-4-5-17-6-8-19(9-7-17)20(23)10-11-21(24)22-14-12-18(13-15-22)16(2)3/h6-11,16,18H,4-5,12-15H2,1-3H3/b11-10+ |
| InChIKey | DQDNRMVDRPNBQE-ZHACJKMWSA-N |
| XLogP | 4.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|