C11H19N — CID 176699137
5-propan-2-yl-6-propyl-2,3-dihydropyridine (PubChem CID 176699137) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 5-propan-2-yl-6-propyl-2,3-dihydropyridine.
| Compound Name | 5-propan-2-yl-6-propyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 176699137 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 5-propan-2-yl-6-propyl-2,3-dihydropyridine |
| SMILES | CCCC1=NCCC=C1C(C)C |
| InChI | InChI=1S/C11H19N/c1-4-6-11-10(9(2)3)7-5-8-12-11/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | WENBUNYGYBDZFO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |