C15H25FN2O — CID 176701022
1-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethyl]piperazine (PubChem CID 176701022) has the molecular formula C15H25FN2O and a molecular weight of 268.38 g/mol. Its IUPAC name is 1-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethyl]piperazine.
| Compound Name | 1-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethyl]piperazine |
|---|---|
| PubChem CID | 176701022 |
| Molecular Formula | C15H25FN2O |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-[2-[(3E)-2-fluoro-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxyethyl]piperazine |
| SMILES | C=C(F)/C=C(/OCCN1CCNCC1)C(=C)C(C)C |
| InChI | InChI=1S/C15H25FN2O/c1-12(2)14(4)15(11-13(3)16)19-10-9-18-7-5-17-6-8-18/h11-12,17H,3-10H2,1-2H3/b15-11+ |
| InChIKey | NBAUSYPPDYLMCP-RVDMUPIBSA-N |
| XLogP | 2.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|