C13H22FNO2 — CID 176701265
3-[[(3E)-2-fluoro-5-methylidenehepta-1,3-dien-4-yl]oxymethyl]morpholine;molecular hydrogen (PubChem CID 176701265) has the molecular formula C13H22FNO2 and a molecular weight of 243.32 g/mol. Its IUPAC name is 3-[[(3E)-2-fluoro-5-methylidenehepta-1,3-dien-4-yl]oxymethyl]morpholine;molecular hydrogen.
| Compound Name | 3-[[(3E)-2-fluoro-5-methylidenehepta-1,3-dien-4-yl]oxymethyl]morpholine;molecular hydrogen |
|---|---|
| PubChem CID | 176701265 |
| Molecular Formula | C13H22FNO2 |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 3-[[(3E)-2-fluoro-5-methylidenehepta-1,3-dien-4-yl]oxymethyl]morpholine;molecular hydrogen |
| SMILES | C=C(F)/C=C(/OCC1COCCN1)C(=C)CC.[H][H] |
| InChI | InChI=1S/C13H20FNO2.H2/c1-4-10(2)13(7-11(3)14)17-9-12-8-16-6-5-15-12;/h7,12,15H,2-6,8-9H2,1H3;1H/b13-7+; |
| InChIKey | GFSSNRFLUGQKOD-FTPOTTDRSA-N |
| XLogP | 2.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|