C13H23NO2 — CID 102648238
(Z)-4-(3,4-dihydro-2H-pyran-6-yl)-N-(2-methoxyethyl)pent-3-en-1-amine (PubChem CID 102648238) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (Z)-4-(3,4-dihydro-2H-pyran-6-yl)-N-(2-methoxyethyl)pent-3-en-1-amine.
| Compound Name | (Z)-4-(3,4-dihydro-2H-pyran-6-yl)-N-(2-methoxyethyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 102648238 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (Z)-4-(3,4-dihydro-2H-pyran-6-yl)-N-(2-methoxyethyl)pent-3-en-1-amine |
| SMILES | COCCNCC/C=C(/C)C1=CCCCO1 |
| InChI | InChI=1S/C13H23NO2/c1-12(13-7-3-4-10-16-13)6-5-8-14-9-11-15-2/h6-7,14H,3-5,8-11H2,1-2H3/b12-6- |
| InChIKey | ZOTGVVQDMXULIW-SDQBBNPISA-N |
| XLogP | 2.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|