C16H30N2O — CID 171827551
1-[2-[(3Z,5Z)-2,3-dimethylocta-3,5-dien-4-yl]oxyethyl]piperazine (PubChem CID 171827551) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-[2-[(3Z,5Z)-2,3-dimethylocta-3,5-dien-4-yl]oxyethyl]piperazine.
| Compound Name | 1-[2-[(3Z,5Z)-2,3-dimethylocta-3,5-dien-4-yl]oxyethyl]piperazine |
|---|---|
| PubChem CID | 171827551 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-[2-[(3Z,5Z)-2,3-dimethylocta-3,5-dien-4-yl]oxyethyl]piperazine |
| SMILES | CC/C=C\C(OCCN1CCNCC1)=C(/C)C(C)C |
| InChI | InChI=1S/C16H30N2O/c1-5-6-7-16(15(4)14(2)3)19-13-12-18-10-8-17-9-11-18/h6-7,14,17H,5,8-13H2,1-4H3/b7-6-,16-15- |
| InChIKey | PIQLXFKGEBTVSC-OYAITDOQSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|