C14H24N2O — CID 143935692
1-methyl-4-[2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyethyl]piperazine (PubChem CID 143935692) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-methyl-4-[2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyethyl]piperazine.
| Compound Name | 1-methyl-4-[2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyethyl]piperazine |
|---|---|
| PubChem CID | 143935692 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-methyl-4-[2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxyethyl]piperazine |
| SMILES | C=C(C)/C=C\C(=C)OCCN1CCN(C)CC1 |
| InChI | InChI=1S/C14H24N2O/c1-13(2)5-6-14(3)17-12-11-16-9-7-15(4)8-10-16/h5-6H,1,3,7-12H2,2,4H3/b6-5- |
| InChIKey | WATXXKIOSQZWAM-WAYWQWQTSA-N |
| XLogP | 1.90 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|