C16H24F3NO — CID 176701386
3-[(3E)-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxy-1-(2,2,2-trifluoroethyl)piperidine (PubChem CID 176701386) has the molecular formula C16H24F3NO and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-[(3E)-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxy-1-(2,2,2-trifluoroethyl)piperidine.
| Compound Name | 3-[(3E)-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxy-1-(2,2,2-trifluoroethyl)piperidine |
|---|---|
| PubChem CID | 176701386 |
| Molecular Formula | C16H24F3NO |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-[(3E)-6-methyl-5-methylidenehepta-1,3-dien-4-yl]oxy-1-(2,2,2-trifluoroethyl)piperidine |
| SMILES | C=C/C=C(/OC1CCCN(CC(F)(F)F)C1)C(=C)C(C)C |
| InChI | InChI=1S/C16H24F3NO/c1-5-7-15(13(4)12(2)3)21-14-8-6-9-20(10-14)11-16(17,18)19/h5,7,12,14H,1,4,6,8-11H2,2-3H3/b15-7+ |
| InChIKey | KWFNHNPFKNVLEP-VIZOYTHASA-N |
| XLogP | 4.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|