C15H23N3O — CID 176703184
1-(2-tert-butyl-6,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one (PubChem CID 176703184) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-(2-tert-butyl-6,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one.
| Compound Name | 1-(2-tert-butyl-6,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 176703184 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-(2-tert-butyl-6,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2cc(C(C)(C)C)nn2C(C)C1C |
| InChI | InChI=1S/C15H23N3O/c1-7-14(19)17-9-12-8-13(15(4,5)6)16-18(12)11(3)10(17)2/h7-8,10-11H,1,9H2,2-6H3 |
| InChIKey | YTBXIIBVLBODKT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|