C14H20FN3O — CID 176827691
1-(2-tert-butyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-2-fluoroprop-2-en-1-one (PubChem CID 176827691) has the molecular formula C14H20FN3O and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-(2-tert-butyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-2-fluoroprop-2-en-1-one.
| Compound Name | 1-(2-tert-butyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 176827691 |
| Molecular Formula | C14H20FN3O |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-(2-tert-butyl-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1Cc2cc(C(C)(C)C)nn2CC1C |
| InChI | InChI=1S/C14H20FN3O/c1-9-7-18-11(6-12(16-18)14(3,4)5)8-17(9)13(19)10(2)15/h6,9H,2,7-8H2,1,3-5H3 |
| InChIKey | GQNXJBKUGIDDLR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|