C12H16FN3O — CID 176702095
2-fluoro-1-(2,4,7-trimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one (PubChem CID 176702095) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-fluoro-1-(2,4,7-trimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one.
| Compound Name | 2-fluoro-1-(2,4,7-trimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 176702095 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-fluoro-1-(2,4,7-trimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl)prop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CC(C)n2nc(C)cc2C1C |
| InChI | InChI=1S/C12H16FN3O/c1-7-5-11-10(4)15(12(17)9(3)13)6-8(2)16(11)14-7/h5,8,10H,3,6H2,1-2,4H3 |
| InChIKey | MEPWQQRUXCBBFA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|