C16H31ClN6 — CID 176704347
3-chloro-2-(2,5-dimethyl-1,5-dihydro-1,2,4-triazol-3-yl)-5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine;ethane (PubChem CID 176704347) has the molecular formula C16H31ClN6 and a molecular weight of 342.92 g/mol. Its IUPAC name is 3-chloro-2-(2,5-dimethyl-1,5-dihydro-1,2,4-triazol-3-yl)-5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine;ethane.
| Compound Name | 3-chloro-2-(2,5-dimethyl-1,5-dihydro-1,2,4-triazol-3-yl)-5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine;ethane |
|---|---|
| PubChem CID | 176704347 |
| Molecular Formula | C16H31ClN6 |
| Molecular Weight | 342.92 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 3-chloro-2-(2,5-dimethyl-1,5-dihydro-1,2,4-triazol-3-yl)-5-methyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine;ethane |
| SMILES | CC.CC.CC1N=C(c2nn3c(c2Cl)CN(C)CCC3)N(C)N1 |
| InChI | InChI=1S/C12H19ClN6.2C2H6/c1-8-14-12(18(3)15-8)11-10(13)9-7-17(2)5-4-6-19(9)16-11;2*1-2/h8,15H,4-7H2,1-3H3;2*1-2H3 |
| InChIKey | PGFYAOWLLYTONJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |