C22H23N5O4 — CID 176705203
4-[[3-[2-(hydroxymethyl)morpholin-4-yl]benzoyl]amino]-1-phenylpyrazole-3-carboxamide (PubChem CID 176705203) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 4-[[3-[2-(hydroxymethyl)morpholin-4-yl]benzoyl]amino]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 4-[[3-[2-(hydroxymethyl)morpholin-4-yl]benzoyl]amino]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 176705203 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 4-[[3-[2-(hydroxymethyl)morpholin-4-yl]benzoyl]amino]-1-phenylpyrazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccccc2)cc1NC(=O)c1cccc(N2CCOC(CO)C2)c1 |
| InChI | InChI=1S/C22H23N5O4/c23-21(29)20-19(13-27(25-20)16-6-2-1-3-7-16)24-22(30)15-5-4-8-17(11-15)26-9-10-31-18(12-26)14-28/h1-8,11,13,18,28H,9-10,12,14H2,(H2,23,29)(H,24,30) |
| InChIKey | VIEBEBPMZYBTQD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |