C16H24N4 — CID 176706085
(2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methyl-4-(4-methyl-1,2,4-triazol-3-yl)piperidine (PubChem CID 176706085) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is (2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methyl-4-(4-methyl-1,2,4-triazol-3-yl)piperidine.
| Compound Name | (2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methyl-4-(4-methyl-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 176706085 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (2R,4R)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-2-methyl-4-(4-methyl-1,2,4-triazol-3-yl)piperidine |
| SMILES | C=C/C=C(\C=C)CN1CC[C@@H](c2nncn2C)C[C@H]1C |
| InChI | InChI=1S/C16H24N4/c1-5-7-14(6-2)11-20-9-8-15(10-13(20)3)16-18-17-12-19(16)4/h5-7,12-13,15H,1-2,8-11H2,3-4H3/b14-7+/t13-,15-/m1/s1 |
| InChIKey | UQOAKUXKAHAEBS-ZWJJSVNDSA-N |
| XLogP | 2.68 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|