C17H28N4 — CID 99858007
1-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-4-(4-methyl-1,2,4-triazol-3-yl)piperidine (PubChem CID 99858007) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-4-(4-methyl-1,2,4-triazol-3-yl)piperidine.
| Compound Name | 1-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-4-(4-methyl-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 99858007 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-4-(4-methyl-1,2,4-triazol-3-yl)piperidine |
| SMILES | CC1=CCC[C@H](C)[C@H]1CN1CCC(c2nncn2C)CC1 |
| InChI | InChI=1S/C17H28N4/c1-13-5-4-6-14(2)16(13)11-21-9-7-15(8-10-21)17-19-18-12-20(17)3/h5,12,14-16H,4,6-11H2,1-3H3/t14-,16-/m0/s1 |
| InChIKey | XSPSGNDQEZXMNZ-HOCLYGCPSA-N |
| XLogP | 2.99 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|