C18H26N4 — CID 176706087
(4R)-2-cyclopropyl-1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(4-methyl-1,2,4-triazol-3-yl)piperidine (PubChem CID 176706087) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is (4R)-2-cyclopropyl-1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(4-methyl-1,2,4-triazol-3-yl)piperidine.
| Compound Name | (4R)-2-cyclopropyl-1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(4-methyl-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 176706087 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | (4R)-2-cyclopropyl-1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(4-methyl-1,2,4-triazol-3-yl)piperidine |
| SMILES | C=C/C=C(\C=C)CN1CC[C@@H](c2nncn2C)CC1C1CC1 |
| InChI | InChI=1S/C18H26N4/c1-4-6-14(5-2)12-22-10-9-16(11-17(22)15-7-8-15)18-20-19-13-21(18)3/h4-6,13,15-17H,1-2,7-12H2,3H3/b14-6+/t16-,17?/m1/s1 |
| InChIKey | MWDCXLOQDUOTES-KSKOVVDESA-N |
| XLogP | 3.07 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|