C14H24N2O5 — CID 176706210
tert-butyl 2-[3-[(prop-2-enoxycarbonylamino)methyl]azetidin-3-yl]oxyacetate (PubChem CID 176706210) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is tert-butyl 2-[3-[(prop-2-enoxycarbonylamino)methyl]azetidin-3-yl]oxyacetate.
| Compound Name | tert-butyl 2-[3-[(prop-2-enoxycarbonylamino)methyl]azetidin-3-yl]oxyacetate |
|---|---|
| PubChem CID | 176706210 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | tert-butyl 2-[3-[(prop-2-enoxycarbonylamino)methyl]azetidin-3-yl]oxyacetate |
| SMILES | C=CCOC(=O)NCC1(OCC(=O)OC(C)(C)C)CNC1 |
| InChI | InChI=1S/C14H24N2O5/c1-5-6-19-12(18)16-10-14(8-15-9-14)20-7-11(17)21-13(2,3)4/h5,15H,1,6-10H2,2-4H3,(H,16,18) |
| InChIKey | KICODCWFFAXLGK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|