C19H32N2O4 — CID 176719507
tert-butyl N-[(1R,2R)-1-[(4,4-dimethylpent-2-enoxycarbonylamino)methyl]-2-ethenylcyclopropyl]carbamate (PubChem CID 176719507) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1-[(4,4-dimethylpent-2-enoxycarbonylamino)methyl]-2-ethenylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1-[(4,4-dimethylpent-2-enoxycarbonylamino)methyl]-2-ethenylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 176719507 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1-[(4,4-dimethylpent-2-enoxycarbonylamino)methyl]-2-ethenylcyclopropyl]carbamate |
| SMILES | C=C[C@H]1C[C@@]1(CNC(=O)OCC=CC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N2O4/c1-8-14-12-19(14,21-16(23)25-18(5,6)7)13-20-15(22)24-11-9-10-17(2,3)4/h8-10,14H,1,11-13H2,2-7H3,(H,20,22)(H,21,23)/t14-,19-/m0/s1 |
| InChIKey | DMNOJCLNNFGMFH-LIRRHRJNSA-N |
| XLogP | 3.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|