C10H16INO2 — CID 89201848
tert-butyl N-[(1S,2S)-2-ethenyl-1-iodocyclopropyl]carbamate (PubChem CID 89201848) has the molecular formula C10H16INO2 and a molecular weight of 309.15 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-ethenyl-1-iodocyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-2-ethenyl-1-iodocyclopropyl]carbamate |
|---|---|
| PubChem CID | 89201848 |
| Molecular Formula | C10H16INO2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-ethenyl-1-iodocyclopropyl]carbamate |
| SMILES | C=C[C@@H]1C[C@@]1(I)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H16INO2/c1-5-7-6-10(7,11)12-8(13)14-9(2,3)4/h5,7H,1,6H2,2-4H3,(H,12,13)/t7-,10-/m1/s1 |
| InChIKey | ZJMWBADNMFRJSB-GMSGAONNSA-N |
| XLogP | 2.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|