C22H31NO8 — CID 91605875
tert-butyl N-[(1S,2R)-1-acetyl-2-ethenylcyclopropyl]carbamate;cis-methyl (1R,2R)-2-ethenyl-1-(2-methoxy-2-oxoacetyl)cyclopropane-1-carboxylate (PubChem CID 91605875) has the molecular formula C22H31NO8 and a molecular weight of 437.49 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-1-acetyl-2-ethenylcyclopropyl]carbamate;cis-methyl (1R,2R)-2-ethenyl-1-(2-methoxy-2-oxoacetyl)cyclopropane-1-carboxylate.
| Compound Name | tert-butyl N-[(1S,2R)-1-acetyl-2-ethenylcyclopropyl]carbamate;cis-methyl (1R,2R)-2-ethenyl-1-(2-methoxy-2-oxoacetyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 91605875 |
| Molecular Formula | C22H31NO8 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | tert-butyl N-[(1S,2R)-1-acetyl-2-ethenylcyclopropyl]carbamate;cis-methyl (1R,2R)-2-ethenyl-1-(2-methoxy-2-oxoacetyl)cyclopropane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@@]1(NC(=O)OC(C)(C)C)C(C)=O.C=C[C@H]1C[C@]1(C(=O)OC)C(=O)C(=O)OC |
| InChI | InChI=1S/C12H19NO3.C10H12O5/c1-6-9-7-12(9,8(2)14)13-10(15)16-11(3,4)5;1-4-6-5-10(6,9(13)15-3)7(11)8(12)14-2/h6,9H,1,7H2,2-5H3,(H,13,15);4,6H,1,5H2,2-3H3/t9-,12+;6-,10+/m00/s1 |
| InChIKey | DYLNNGWBQQLAIZ-JZSFAERNSA-N |
| XLogP | 2.14 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|